C26H28N2O4 — CID 58131011
[(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-1-(3,5-dimethylphenyl)-4-methyl-2,6-dioxo-3-pyridinyl] formate (PubChem CID 58131011) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is [(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-1-(3,5-dimethylphenyl)-4-methyl-2,6-dioxo-3-pyridinyl] formate.
| Compound Name | [(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-1-(3,5-dimethylphenyl)-4-methyl-2,6-dioxo-3-pyridinyl] formate |
|---|---|
| PubChem CID | 58131011 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-1-(3,5-dimethylphenyl)-4-methyl-2,6-dioxo-3-pyridinyl] formate |
| SMILES | CCN(CC)c1ccc(/C=C2\C(=O)N(c3cc(C)cc(C)c3)C(=O)C(OC=O)=C2C)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-6-27(7-2)21-10-8-20(9-11-21)15-23-19(5)24(32-16-29)26(31)28(25(23)30)22-13-17(3)12-18(4)14-22/h8-16H,6-7H2,1-5H3/b23-15- |
| InChIKey | XOGAALIICDQCMJ-HAHDFKILSA-N |
| XLogP | 4.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|