C50H48N2 — CID 58131780
2,12-ditert-butyl-7,8,17,18-tetramethyl-6,16-dinaphthalen-2-yl-6,16-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene (PubChem CID 58131780) has the molecular formula C50H48N2 and a molecular weight of 676.95 g/mol. Its IUPAC name is 2,12-ditert-butyl-7,8,17,18-tetramethyl-6,16-dinaphthalen-2-yl-6,16-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene.
| Compound Name | 2,12-ditert-butyl-7,8,17,18-tetramethyl-6,16-dinaphthalen-2-yl-6,16-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene |
|---|---|
| PubChem CID | 58131780 |
| Molecular Formula | C50H48N2 |
| Molecular Weight | 676.95 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | 2,12-ditert-butyl-7,8,17,18-tetramethyl-6,16-dinaphthalen-2-yl-6,16-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene |
| SMILES | Cc1c(C)n(-c2ccc3ccccc3c2)c2cc3c(C(C)(C)C)c4cc5c(C)c(C)n(-c6ccc7ccccc7c6)c5cc4c(C(C)(C)C)c3cc12 |
| InChI | InChI=1S/C50H48N2/c1-29-31(3)51(37-21-19-33-15-11-13-17-35(33)23-37)45-27-43-41(25-39(29)45)47(49(5,6)7)44-28-46-40(26-42(44)48(43)50(8,9)10)30(2)32(4)52(46)38-22-20-34-16-12-14-18-36(34)24-38/h11-28H,1-10H3 |
| InChIKey | JWRMEPKYFWDVMV-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.95 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|