C36H37N — CID 58161270
5,10-ditert-butyl-2,3-dimethyl-1-naphthalen-2-ylnaphtho[2,3-f]indole (PubChem CID 58161270) has the molecular formula C36H37N and a molecular weight of 483.70 g/mol. Its IUPAC name is 5,10-ditert-butyl-2,3-dimethyl-1-naphthalen-2-ylnaphtho[2,3-f]indole.
| Compound Name | 5,10-ditert-butyl-2,3-dimethyl-1-naphthalen-2-ylnaphtho[2,3-f]indole |
|---|---|
| PubChem CID | 58161270 |
| Molecular Formula | C36H37N |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 5,10-ditert-butyl-2,3-dimethyl-1-naphthalen-2-ylnaphtho[2,3-f]indole |
| SMILES | Cc1c(C)n(-c2ccc3ccccc3c2)c2cc3c(C(C)(C)C)c4ccccc4c(C(C)(C)C)c3cc12 |
| InChI | InChI=1S/C36H37N/c1-22-23(2)37(26-18-17-24-13-9-10-14-25(24)19-26)32-21-31-30(20-29(22)32)33(35(3,4)5)27-15-11-12-16-28(27)34(31)36(6,7)8/h9-21H,1-8H3 |
| InChIKey | LKWGGXRKQFSNRU-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|