C11H13NO3 — CID 58134161
(5-ethylfuro[3,2-b]pyrrol-4-yl)methyl acetate (PubChem CID 58134161) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (5-ethylfuro[3,2-b]pyrrol-4-yl)methyl acetate.
| Compound Name | (5-ethylfuro[3,2-b]pyrrol-4-yl)methyl acetate |
|---|---|
| PubChem CID | 58134161 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (5-ethylfuro[3,2-b]pyrrol-4-yl)methyl acetate |
| SMILES | CCc1cc2occc2n1COC(C)=O |
| InChI | InChI=1S/C11H13NO3/c1-3-9-6-11-10(4-5-14-11)12(9)7-15-8(2)13/h4-6H,3,7H2,1-2H3 |
| InChIKey | ALXQWMHDKRTAKW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |