C20H23N5O2 — CID 58135462
N-[6-(2-methoxyphenyl)-1H-indazol-3-yl]-4-methylpiperazine-1-carboxamide (PubChem CID 58135462) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[6-(2-methoxyphenyl)-1H-indazol-3-yl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[6-(2-methoxyphenyl)-1H-indazol-3-yl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 58135462 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[6-(2-methoxyphenyl)-1H-indazol-3-yl]-4-methylpiperazine-1-carboxamide |
| SMILES | COc1ccccc1-c1ccc2c(NC(=O)N3CCN(C)CC3)n[nH]c2c1 |
| InChI | InChI=1S/C20H23N5O2/c1-24-9-11-25(12-10-24)20(26)21-19-16-8-7-14(13-17(16)22-23-19)15-5-3-4-6-18(15)27-2/h3-8,13H,9-12H2,1-2H3,(H2,21,22,23,26) |
| InChIKey | BURACSSHZONNNX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |