C21H27N5O2 — CID 58135522
1-[2-(diethylamino)ethyl]-3-[6-(2-methoxyphenyl)-1H-indazol-3-yl]urea (PubChem CID 58135522) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-[6-(2-methoxyphenyl)-1H-indazol-3-yl]urea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-[6-(2-methoxyphenyl)-1H-indazol-3-yl]urea |
|---|---|
| PubChem CID | 58135522 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-[6-(2-methoxyphenyl)-1H-indazol-3-yl]urea |
| SMILES | CCN(CC)CCNC(=O)Nc1n[nH]c2cc(-c3ccccc3OC)ccc12 |
| InChI | InChI=1S/C21H27N5O2/c1-4-26(5-2)13-12-22-21(27)23-20-17-11-10-15(14-18(17)24-25-20)16-8-6-7-9-19(16)28-3/h6-11,14H,4-5,12-13H2,1-3H3,(H3,22,23,24,25,27) |
| InChIKey | HVYCQAWXYTUXHA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |