C26H38N4O2 — CID 58135745
(2S)-3,3-dimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]-N-(2-methylpropyl)butanamide (PubChem CID 58135745) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]-N-(2-methylpropyl)butanamide.
| Compound Name | (2S)-3,3-dimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 58135745 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]-N-(2-methylpropyl)butanamide |
| SMILES | CC(C)CNC(=O)[C@@H](CC(=O)c1nc(-c2ccccc2)n2c1CN(C)CCC2)C(C)(C)C |
| InChI | InChI=1S/C26H38N4O2/c1-18(2)16-27-25(32)20(26(3,4)5)15-22(31)23-21-17-29(6)13-10-14-30(21)24(28-23)19-11-8-7-9-12-19/h7-9,11-12,18,20H,10,13-17H2,1-6H3,(H,27,32)/t20-/m1/s1 |
| InChIKey | JPZZFEMCGBUKQS-HXUWFJFHSA-N |
| XLogP | 4.39 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |