About 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one
1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one (PubChem CID 58136949) has the molecular formula C11H13F5O2S
and a molecular weight of 304.28 g/mol. Its IUPAC name is 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one.
Molecular Properties
| Compound Name | 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one |
| PubChem CID | 58136949 |
| Molecular Formula | C11H13F5O2S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one |
| SMILES | CCOc1cc(C(=O)CC)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F5O2S/c1-3-11(17)8-5-9(18-4-2)7-10(6-8)19(12,13,14,15)16/h5-7H,3-4H2,1-2H3 |
| InChIKey | ORHVYVCXHPLTIL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one?
The IUPAC name of 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one (CID 58136949) is 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one.
What is the SMILES notation for 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one?
The canonical SMILES for 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one is CCOc1cc(C(=O)CC)cc(S(F)(F)(F)(F)F)c1.
What is the InChIKey of 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one?
The InChIKey is ORHVYVCXHPLTIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F5O2S/c1-3-11(17)8-5-9(18-4-2)7-10(6-8)19(12,13,14,15)16/h5-7H,3-4H2,1-2H3.
What are the key properties of 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one?
1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one has a molecular weight of 304.28 g/mol, XLogP of 5.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-ethoxy-5-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-one is sourced from PubChem (CID 58136949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).