C19H14ClFN4O3 — CID 58138357
4-benzamido-N-[(4-chlorophenyl)methyl]-5-fluoro-2-oxopyrimidine-1-carboxamide (PubChem CID 58138357) has the molecular formula C19H14ClFN4O3 and a molecular weight of 400.80 g/mol. Its IUPAC name is 4-benzamido-N-[(4-chlorophenyl)methyl]-5-fluoro-2-oxopyrimidine-1-carboxamide.
| Compound Name | 4-benzamido-N-[(4-chlorophenyl)methyl]-5-fluoro-2-oxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 58138357 |
| Molecular Formula | C19H14ClFN4O3 |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 4-benzamido-N-[(4-chlorophenyl)methyl]-5-fluoro-2-oxopyrimidine-1-carboxamide |
| SMILES | O=C(Nc1nc(=O)n(C(=O)NCc2ccc(Cl)cc2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C19H14ClFN4O3/c20-14-8-6-12(7-9-14)10-22-18(27)25-11-15(21)16(24-19(25)28)23-17(26)13-4-2-1-3-5-13/h1-9,11H,10H2,(H,22,27)(H,23,24,26,28) |
| InChIKey | VHSBIQICLFRIOT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |