C16H13ClFN3O4 — CID 10237167
4-chloro-N-[5-fluoro-1-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 10237167) has the molecular formula C16H13ClFN3O4 and a molecular weight of 365.75 g/mol. Its IUPAC name is 4-chloro-N-[5-fluoro-1-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | 4-chloro-N-[5-fluoro-1-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 10237167 |
| Molecular Formula | C16H13ClFN3O4 |
| Molecular Weight | 365.75 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 4-chloro-N-[5-fluoro-1-[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | O=C(Nc1nc(=O)n(C2C=CC(CO)O2)cc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClFN3O4/c17-10-3-1-9(2-4-10)15(23)19-14-12(18)7-21(16(24)20-14)13-6-5-11(8-22)25-13/h1-7,11,13,22H,8H2,(H,19,20,23,24) |
| InChIKey | NRCRQRCTRROGJG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.75 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|