About 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate
2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate (PubChem CID 58138996) has the molecular formula C22H16F4N2O4
and a molecular weight of 448.37 g/mol. Its IUPAC name is 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate |
| PubChem CID | 58138996 |
| Molecular Formula | C22H16F4N2O4 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate |
| SMILES | CC(=O)OCCc1cc(F)c(-n2c(N)c(C(=O)c3ccc(F)cc3F)ccc2=O)c(F)c1 |
| InChI | InChI=1S/C22H16F4N2O4/c1-11(29)32-7-6-12-8-17(25)20(18(26)9-12)28-19(30)5-4-15(22(28)27)21(31)14-3-2-13(23)10-16(14)24/h2-5,8-10H,6-7,27H2,1H3 |
| InChIKey | QERUYQWQEDDBOE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate?
The IUPAC name of 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate (CID 58138996) is 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate.
What is the SMILES notation for 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate?
The canonical SMILES for 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate is CC(=O)OCCc1cc(F)c(-n2c(N)c(C(=O)c3ccc(F)cc3F)ccc2=O)c(F)c1.
What is the InChIKey of 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate?
The InChIKey is QERUYQWQEDDBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F4N2O4/c1-11(29)32-7-6-12-8-17(25)20(18(26)9-12)28-19(30)5-4-15(22(28)27)21(31)14-3-2-13(23)10-16(14)24/h2-5,8-10H,6-7,27H2,1H3.
What are the key properties of 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate?
2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate has a molecular weight of 448.37 g/mol, XLogP of 3.31, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenyl]ethyl acetate is sourced from PubChem (CID 58138996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).