C29H23F4N3O5 — CID 122603410
[3-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]propylamino] 2-phenylacetate (PubChem CID 122603410) has the molecular formula C29H23F4N3O5 and a molecular weight of 569.51 g/mol. Its IUPAC name is [3-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]propylamino] 2-phenylacetate.
| Compound Name | [3-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]propylamino] 2-phenylacetate |
|---|---|
| PubChem CID | 122603410 |
| Molecular Formula | C29H23F4N3O5 |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | [3-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]propylamino] 2-phenylacetate |
| SMILES | Nc1c(C(=O)c2ccc(F)cc2F)ccc(=O)n1-c1c(F)cc(OCCCNOC(=O)Cc2ccccc2)cc1F |
| InChI | InChI=1S/C29H23F4N3O5/c30-18-7-8-20(22(31)14-18)28(39)21-9-10-25(37)36(29(21)34)27-23(32)15-19(16-24(27)33)40-12-4-11-35-41-26(38)13-17-5-2-1-3-6-17/h1-3,5-10,14-16,35H,4,11-13,34H2 |
| InChIKey | RGSBLRBLDFQWDT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|