C29H31F4N3O3 — CID 89322928
6-amino-1-[2,6-difluoro-4-[3-[[(3S)-2-hydroxy-5-methylhex-1-en-3-yl]amino]propoxy]phenyl]-5-[1-(2,4-difluorophenyl)ethenyl]pyridin-2-one (PubChem CID 89322928) has the molecular formula C29H31F4N3O3 and a molecular weight of 545.58 g/mol. Its IUPAC name is 6-amino-1-[2,6-difluoro-4-[3-[[(3S)-2-hydroxy-5-methylhex-1-en-3-yl]amino]propoxy]phenyl]-5-[1-(2,4-difluorophenyl)ethenyl]pyridin-2-one.
| Compound Name | 6-amino-1-[2,6-difluoro-4-[3-[[(3S)-2-hydroxy-5-methylhex-1-en-3-yl]amino]propoxy]phenyl]-5-[1-(2,4-difluorophenyl)ethenyl]pyridin-2-one |
|---|---|
| PubChem CID | 89322928 |
| Molecular Formula | C29H31F4N3O3 |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 6-amino-1-[2,6-difluoro-4-[3-[[(3S)-2-hydroxy-5-methylhex-1-en-3-yl]amino]propoxy]phenyl]-5-[1-(2,4-difluorophenyl)ethenyl]pyridin-2-one |
| SMILES | C=C(c1ccc(F)cc1F)c1ccc(=O)n(-c2c(F)cc(OCCCN[C@@H](CC(C)C)C(=C)O)cc2F)c1N |
| InChI | InChI=1S/C29H31F4N3O3/c1-16(2)12-26(18(4)37)35-10-5-11-39-20-14-24(32)28(25(33)15-20)36-27(38)9-8-22(29(36)34)17(3)21-7-6-19(30)13-23(21)31/h6-9,13-16,26,35,37H,3-5,10-12,34H2,1-2H3/t26-/m0/s1 |
| InChIKey | NFGLUQAJLYOVDV-SANMLTNESA-N |
| XLogP | 5.88 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|