C30H28Cl3FN2O4 — CID 71097203
(2S)-2-[3-[5-(2-chloro-4-fluorophenyl)-1-(2,6-dichlorophenyl)-2-oxoquinolin-7-yl]oxypropylamino]-4-methylpentanoic acid (PubChem CID 71097203) has the molecular formula C30H28Cl3FN2O4 and a molecular weight of 605.92 g/mol. Its IUPAC name is (2S)-2-[3-[5-(2-chloro-4-fluorophenyl)-1-(2,6-dichlorophenyl)-2-oxoquinolin-7-yl]oxypropylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[3-[5-(2-chloro-4-fluorophenyl)-1-(2,6-dichlorophenyl)-2-oxoquinolin-7-yl]oxypropylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 71097203 |
| Molecular Formula | C30H28Cl3FN2O4 |
| Molecular Weight | 605.92 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | (2S)-2-[3-[5-(2-chloro-4-fluorophenyl)-1-(2,6-dichlorophenyl)-2-oxoquinolin-7-yl]oxypropylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NCCCOc1cc(-c2ccc(F)cc2Cl)c2ccc(=O)n(-c3c(Cl)cccc3Cl)c2c1)C(=O)O |
| InChI | InChI=1S/C30H28Cl3FN2O4/c1-17(2)13-26(30(38)39)35-11-4-12-40-19-15-22(20-8-7-18(34)14-25(20)33)21-9-10-28(37)36(27(21)16-19)29-23(31)5-3-6-24(29)32/h3,5-10,14-17,26,35H,4,11-13H2,1-2H3,(H,38,39)/t26-/m0/s1 |
| InChIKey | GEYMVKUVAJKKBW-SANMLTNESA-N |
| XLogP | 7.61 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.92 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|