C34H31F4N3O5 — CID 24798168
cyclopentyl (2R)-2-[3-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]propylamino]-2-phenylacetate (PubChem CID 24798168) has the molecular formula C34H31F4N3O5 and a molecular weight of 637.63 g/mol. Its IUPAC name is cyclopentyl (2R)-2-[3-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]propylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2R)-2-[3-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]propylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 24798168 |
| Molecular Formula | C34H31F4N3O5 |
| Molecular Weight | 637.63 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | cyclopentyl (2R)-2-[3-[4-[2-amino-3-(2,4-difluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]propylamino]-2-phenylacetate |
| SMILES | Nc1c(C(=O)c2ccc(F)cc2F)ccc(=O)n1-c1c(F)cc(OCCCN[C@@H](C(=O)OC2CCCC2)c2ccccc2)cc1F |
| InChI | InChI=1S/C34H31F4N3O5/c35-21-11-12-24(26(36)17-21)32(43)25-13-14-29(42)41(33(25)39)31-27(37)18-23(19-28(31)38)45-16-6-15-40-30(20-7-2-1-3-8-20)34(44)46-22-9-4-5-10-22/h1-3,7-8,11-14,17-19,22,30,40H,4-6,9-10,15-16,39H2/t30-/m1/s1 |
| InChIKey | URZKKVBVELEHEL-SSEXGKCCSA-N |
| XLogP | 5.79 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|