C9H19NO2 — CID 58139943
N,N-dimethyl-4-propan-2-yloxybutanamide (PubChem CID 58139943) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is N,N-dimethyl-4-propan-2-yloxybutanamide.
| Compound Name | N,N-dimethyl-4-propan-2-yloxybutanamide |
|---|---|
| PubChem CID | 58139943 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | N,N-dimethyl-4-propan-2-yloxybutanamide |
| SMILES | CC(C)OCCCC(=O)N(C)C |
| InChI | InChI=1S/C9H19NO2/c1-8(2)12-7-5-6-9(11)10(3)4/h8H,5-7H2,1-4H3 |
| InChIKey | PYXHCCRULGJOEA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|