C73H82 — CID 58142028
9,9-bis[3,5-bis[3,5-di(propan-2-yl)phenyl]phenyl]fluorene (PubChem CID 58142028) has the molecular formula C73H82 and a molecular weight of 959.46 g/mol. Its IUPAC name is 9,9-bis[3,5-bis[3,5-di(propan-2-yl)phenyl]phenyl]fluorene.
| Compound Name | 9,9-bis[3,5-bis[3,5-di(propan-2-yl)phenyl]phenyl]fluorene |
|---|---|
| PubChem CID | 58142028 |
| Molecular Formula | C73H82 |
| Molecular Weight | 959.46 g/mol |
| Exact Mass | 958.64 |
| IUPAC Name | 9,9-bis[3,5-bis[3,5-di(propan-2-yl)phenyl]phenyl]fluorene |
| SMILES | CC(C)c1cc(-c2cc(-c3cc(C(C)C)cc(C(C)C)c3)cc(C3(c4cc(-c5cc(C(C)C)cc(C(C)C)c5)cc(-c5cc(C(C)C)cc(C(C)C)c5)c4)c4ccccc4-c4ccccc43)c2)cc(C(C)C)c1 |
| InChI | InChI=1S/C73H82/c1-43(2)51-25-52(44(3)4)30-59(29-51)63-37-64(60-31-53(45(5)6)26-54(32-60)46(7)8)40-67(39-63)73(71-23-19-17-21-69(71)70-22-18-20-24-72(70)73)68-41-65(61-33-55(47(9)10)27-56(34-61)48(11)12)38-66(42-68)62-35-57(49(13)14)28-58(36-62)50(15)16/h17-50H,1-16H3 |
| InChIKey | OWJOJQLYLIGIJF-UHFFFAOYSA-N |
| XLogP | 21.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.46 |
| LogP ≤ 5 | 21.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |