C19H21N5O — CID 58146765
7-[(5-cyano-2-adamantyl)amino]-3H-pyrrolo[3,2-b]pyridine-6-carboxamide (PubChem CID 58146765) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 7-[(5-cyano-2-adamantyl)amino]-3H-pyrrolo[3,2-b]pyridine-6-carboxamide.
| Compound Name | 7-[(5-cyano-2-adamantyl)amino]-3H-pyrrolo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 58146765 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 7-[(5-cyano-2-adamantyl)amino]-3H-pyrrolo[3,2-b]pyridine-6-carboxamide |
| SMILES | N#CC12CC3CC(C1)C(Nc1c(C(N)=O)cnc4c1N=CC4)C(C3)C2 |
| InChI | InChI=1S/C19H21N5O/c20-9-19-5-10-3-11(6-19)15(12(4-10)7-19)24-16-13(18(21)25)8-23-14-1-2-22-17(14)16/h2,8,10-12,15H,1,3-7H2,(H2,21,25)(H,23,24) |
| InChIKey | OTCWFKRBGQNBBZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |