C29H31N3O3 — CID 58146771
benzyl 4-[[5-(2-cyanoethoxy)-2-adamantyl]amino]-7H-cyclopenta[b]pyridine-3-carboxylate (PubChem CID 58146771) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is benzyl 4-[[5-(2-cyanoethoxy)-2-adamantyl]amino]-7H-cyclopenta[b]pyridine-3-carboxylate.
| Compound Name | benzyl 4-[[5-(2-cyanoethoxy)-2-adamantyl]amino]-7H-cyclopenta[b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 58146771 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | benzyl 4-[[5-(2-cyanoethoxy)-2-adamantyl]amino]-7H-cyclopenta[b]pyridine-3-carboxylate |
| SMILES | N#CCCOC12CC3CC(C1)C(Nc1c(C(=O)OCc4ccccc4)cnc4c1C=CC4)C(C3)C2 |
| InChI | InChI=1S/C29H31N3O3/c30-10-5-11-35-29-14-20-12-21(15-29)26(22(13-20)16-29)32-27-23-8-4-9-25(23)31-17-24(27)28(33)34-18-19-6-2-1-3-7-19/h1-4,6-8,17,20-22,26H,5,9,11-16,18H2,(H,31,32) |
| InChIKey | WVDWFAHAXPRCGF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|