C18H21FN4O — CID 58146802
7-[(5-fluoro-2-adamantyl)amino]-3H-pyrrolo[3,2-b]pyridine-6-carboxamide (PubChem CID 58146802) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is 7-[(5-fluoro-2-adamantyl)amino]-3H-pyrrolo[3,2-b]pyridine-6-carboxamide.
| Compound Name | 7-[(5-fluoro-2-adamantyl)amino]-3H-pyrrolo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 58146802 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 7-[(5-fluoro-2-adamantyl)amino]-3H-pyrrolo[3,2-b]pyridine-6-carboxamide |
| SMILES | NC(=O)c1cnc2c(c1NC1C3CC4CC1CC(F)(C4)C3)N=CC2 |
| InChI | InChI=1S/C18H21FN4O/c19-18-5-9-3-10(6-18)14(11(4-9)7-18)23-15-12(17(20)24)8-22-13-1-2-21-16(13)15/h2,8-11,14H,1,3-7H2,(H2,20,24)(H,22,23) |
| InChIKey | CIAHMNJJWUUFQT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |