C31H35F3N6O3 — CID 58149630
(2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 58149630) has the molecular formula C31H35F3N6O3 and a molecular weight of 596.65 g/mol. Its IUPAC name is (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 58149630 |
| Molecular Formula | C31H35F3N6O3 |
| Molecular Weight | 596.65 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | CCc1c(NC[C@H](CC(=O)c2cccc(C(F)(F)F)c2)C(=O)O)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C31H35F3N6O3/c1-2-24-28(36-17-22(30(42)43)16-26(41)21-5-3-7-23(15-21)31(32,33)34)37-18-38-29(24)40-13-10-19(11-14-40)25-9-8-20-6-4-12-35-27(20)39-25/h3,5,7-9,15,18-19,22H,2,4,6,10-14,16-17H2,1H3,(H,35,39)(H,42,43)(H,36,37,38)/t22-/m0/s1 |
| InChIKey | RWJXNRPJGQRLTH-QFIPXVFZSA-N |
| XLogP | 5.58 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |