C35H43F3N6O3 — CID 58149645
tert-butyl (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoate (PubChem CID 58149645) has the molecular formula C35H43F3N6O3 and a molecular weight of 652.76 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoate.
| Compound Name | tert-butyl (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 58149645 |
| Molecular Formula | C35H43F3N6O3 |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | tert-butyl (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoate |
| SMILES | CCc1c(NC[C@H](CC(=O)c2cccc(C(F)(F)F)c2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C35H43F3N6O3/c1-5-27-31(40-20-25(33(46)47-34(2,3)4)19-29(45)24-8-6-10-26(18-24)35(36,37)38)41-21-42-32(27)44-16-13-22(14-17-44)28-12-11-23-9-7-15-39-30(23)43-28/h6,8,10-12,18,21-22,25H,5,7,9,13-17,19-20H2,1-4H3,(H,39,43)(H,40,41,42)/t25-/m0/s1 |
| InChIKey | CZOLRCUEMRQWOQ-VWLOTQADSA-N |
| XLogP | 6.84 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |