C23H21ClF3N7 — CID 58155505
8-(2-chloro-5-fluoro-3-pyridinyl)-N-[(3,4-difluorophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine (PubChem CID 58155505) has the molecular formula C23H21ClF3N7 and a molecular weight of 487.92 g/mol. Its IUPAC name is 8-(2-chloro-5-fluoro-3-pyridinyl)-N-[(3,4-difluorophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine.
| Compound Name | 8-(2-chloro-5-fluoro-3-pyridinyl)-N-[(3,4-difluorophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine |
|---|---|
| PubChem CID | 58155505 |
| Molecular Formula | C23H21ClF3N7 |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 8-(2-chloro-5-fluoro-3-pyridinyl)-N-[(3,4-difluorophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine |
| SMILES | Fc1cnc(Cl)c(-c2nc3cnc(NCc4ccc(F)c(F)c4)nc3n2C[C@@H]2CCCNC2)c1 |
| InChI | InChI=1S/C23H21ClF3N7/c24-20-16(7-15(25)10-29-20)21-32-19-11-31-23(30-9-13-3-4-17(26)18(27)6-13)33-22(19)34(21)12-14-2-1-5-28-8-14/h3-4,6-7,10-11,14,28H,1-2,5,8-9,12H2,(H,30,31,33)/t14-/m1/s1 |
| InChIKey | FXPDJLNXTFXNOY-CQSZACIVSA-N |
| XLogP | 4.57 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|