C24H23F2IN6 — CID 70794297
8-(2-fluoro-6-iodophenyl)-N-[(3-fluorophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine (PubChem CID 70794297) has the molecular formula C24H23F2IN6 and a molecular weight of 560.39 g/mol. Its IUPAC name is 8-(2-fluoro-6-iodophenyl)-N-[(3-fluorophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine.
| Compound Name | 8-(2-fluoro-6-iodophenyl)-N-[(3-fluorophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine |
|---|---|
| PubChem CID | 70794297 |
| Molecular Formula | C24H23F2IN6 |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 8-(2-fluoro-6-iodophenyl)-N-[(3-fluorophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine |
| SMILES | Fc1cccc(CNc2ncc3nc(-c4c(F)cccc4I)n(C[C@@H]4CCCNC4)c3n2)c1 |
| InChI | InChI=1S/C24H23F2IN6/c25-17-6-1-4-15(10-17)12-29-24-30-13-20-22(32-24)33(14-16-5-3-9-28-11-16)23(31-20)21-18(26)7-2-8-19(21)27/h1-2,4,6-8,10,13,16,28H,3,5,9,11-12,14H2,(H,29,30,32)/t16-/m1/s1 |
| InChIKey | WPBBMJWFDUCFNK-MRXNPFEDSA-N |
| XLogP | 4.99 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|