About [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate
[(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate (PubChem CID 58156501) has the molecular formula C17H23FN2O3
and a molecular weight of 322.38 g/mol. Its IUPAC name is [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate |
| PubChem CID | 58156501 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate |
| SMILES | O=C(OC[C@@H]1CCCOC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H23FN2O3/c18-15-3-5-16(6-4-15)19-7-9-20(10-8-19)17(21)23-13-14-2-1-11-22-12-14/h3-6,14H,1-2,7-13H2/t14-/m1/s1 |
| InChIKey | SBZOJYZVRLDEOO-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate?
The IUPAC name of [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate (CID 58156501) is [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate.
What is the SMILES notation for [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate?
The canonical SMILES for [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate is O=C(OC[C@@H]1CCCOC1)N1CCN(c2ccc(F)cc2)CC1.
What is the InChIKey of [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate?
The InChIKey is SBZOJYZVRLDEOO-CQSZACIVSA-N. The full InChI is InChI=1S/C17H23FN2O3/c18-15-3-5-16(6-4-15)19-7-9-20(10-8-19)17(21)23-13-14-2-1-11-22-12-14/h3-6,14H,1-2,7-13H2/t14-/m1/s1.
What are the key properties of [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate?
[(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate has a molecular weight of 322.38 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-oxan-3-yl]methyl 4-(4-fluorophenyl)piperazine-1-carboxylate is sourced from PubChem (CID 58156501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).