C25H24N2O7S — CID 58159065
2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]-2-[(4-nitrophenyl)sulfonylamino]acetic acid (PubChem CID 58159065) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is 2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]-2-[(4-nitrophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]-2-[(4-nitrophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 58159065 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]-2-[(4-nitrophenyl)sulfonylamino]acetic acid |
| SMILES | C=CC[C@@H]1OC(c2cccc3ccccc23)C[C@@H]1C(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C25H24N2O7S/c1-2-6-22-21(15-23(34-22)20-10-5-8-16-7-3-4-9-19(16)20)24(25(28)29)26-35(32,33)18-13-11-17(12-14-18)27(30)31/h2-5,7-14,21-24,26H,1,6,15H2,(H,28,29)/t21-,22-,23?,24?/m0/s1 |
| InChIKey | GSJBIVKDTKILPE-WOLZVPSQSA-N |
| XLogP | 4.20 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|