C35H29N5O3 — CID 58159672
N-[3-[1-(6-ethylpyrimidin-4-yl)-3-(4-methylphenyl)indol-6-yl]phenyl]-4-methyl-3-nitrobenzamide (PubChem CID 58159672) has the molecular formula C35H29N5O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is N-[3-[1-(6-ethylpyrimidin-4-yl)-3-(4-methylphenyl)indol-6-yl]phenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[3-[1-(6-ethylpyrimidin-4-yl)-3-(4-methylphenyl)indol-6-yl]phenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 58159672 |
| Molecular Formula | C35H29N5O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | N-[3-[1-(6-ethylpyrimidin-4-yl)-3-(4-methylphenyl)indol-6-yl]phenyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCc1cc(-n2cc(-c3ccc(C)cc3)c3ccc(-c4cccc(NC(=O)c5ccc(C)c([N+](=O)[O-])c5)c4)cc32)ncn1 |
| InChI | InChI=1S/C35H29N5O3/c1-4-28-19-34(37-21-36-28)39-20-31(24-11-8-22(2)9-12-24)30-15-14-26(17-33(30)39)25-6-5-7-29(16-25)38-35(41)27-13-10-23(3)32(18-27)40(42)43/h5-21H,4H2,1-3H3,(H,38,41) |
| InChIKey | XRQLNUMSPNJVKT-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|