C12H8N4 — CID 58162469
2,3,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaene (PubChem CID 58162469) has the molecular formula C12H8N4 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,3,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaene.
| Compound Name | 2,3,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 58162469 |
| Molecular Formula | C12H8N4 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2,3,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaene |
| SMILES | c1ccc2c(c1)c1nccn1c1ccnn21 |
| InChI | InChI=1S/C12H8N4/c1-2-4-10-9(3-1)12-13-7-8-15(12)11-5-6-14-16(10)11/h1-8H |
| InChIKey | KICLAMHDZRNEDL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |