C22H13F3IrN3O2- — CID 58162490
12H-imidazo[1,2-f]phenanthridin-12-ide;iridium;4-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 58162490) has the molecular formula C22H13F3IrN3O2- and a molecular weight of 600.58 g/mol. Its IUPAC name is 12H-imidazo[1,2-f]phenanthridin-12-ide;iridium;4-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 12H-imidazo[1,2-f]phenanthridin-12-ide;iridium;4-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58162490 |
| Molecular Formula | C22H13F3IrN3O2- |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | 12H-imidazo[1,2-f]phenanthridin-12-ide;iridium;4-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)ccn1.[Ir].[c-]1cccc2c1c1nccn1c1ccccc21 |
| InChI | InChI=1S/C15H9N2.C7H4F3NO2.Ir/c1-2-7-13-11(5-1)12-6-3-4-8-14(12)17-10-9-16-15(13)17;8-7(9,10)4-1-2-11-5(3-4)6(12)13;/h1-6,8-10H;1-3H,(H,12,13);/q-1;; |
| InChIKey | STMLGWLJNKFAPH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|