C23H18F3IrN4O2- — CID 58426398
4-(2,6-dimethylphenyl)-3-phenyl-5-(trifluoromethyl)-1,2,4-triazole;iridium;pyridine-2-carboxylic acid (PubChem CID 58426398) has the molecular formula C23H18F3IrN4O2- and a molecular weight of 631.63 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-3-phenyl-5-(trifluoromethyl)-1,2,4-triazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 4-(2,6-dimethylphenyl)-3-phenyl-5-(trifluoromethyl)-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426398 |
| Molecular Formula | C23H18F3IrN4O2- |
| Molecular Weight | 631.63 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-3-phenyl-5-(trifluoromethyl)-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1-n1c(-c2[c-]cccc2)nnc1C(F)(F)F.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C17H13F3N3.C6H5NO2.Ir/c1-11-7-6-8-12(2)14(11)23-15(13-9-4-3-5-10-13)21-22-16(23)17(18,19)20;8-6(9)5-3-1-2-4-7-5;/h3-9H,1-2H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | WKMSAMSKRJXMTP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|