C22H20F5IrN4O2- — CID 58426414
4-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid (PubChem CID 58426414) has the molecular formula C22H20F5IrN4O2- and a molecular weight of 659.64 g/mol. Its IUPAC name is 4-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 4-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426414 |
| Molecular Formula | C22H20F5IrN4O2- |
| Molecular Weight | 659.64 g/mol |
| Exact Mass | 660.11 |
| IUPAC Name | 4-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
| SMILES | FC(F)(F)C(F)(F)c1nnc(-c2[c-]cccc2)n1C1CCCCC1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C16H15F5N3.C6H5NO2.Ir/c17-15(18,16(19,20)21)14-23-22-13(11-7-3-1-4-8-11)24(14)12-9-5-2-6-10-12;8-6(9)5-3-1-2-4-7-5;/h1,3-4,7,12H,2,5-6,9-10H2;1-4H,(H,8,9);/q-1;; |
| InChIKey | MARQUWLAVOYYEQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|