C17H15F2IrN4O2- — CID 58426459
3-(1,1-difluoroethyl)-4-methyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid (PubChem CID 58426459) has the molecular formula C17H15F2IrN4O2- and a molecular weight of 537.55 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-4-methyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 3-(1,1-difluoroethyl)-4-methyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426459 |
| Molecular Formula | C17H15F2IrN4O2- |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 3-(1,1-difluoroethyl)-4-methyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
| SMILES | Cn1c(-c2[c-]cccc2)nnc1C(C)(F)F.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C11H10F2N3.C6H5NO2.Ir/c1-11(12,13)10-15-14-9(16(10)2)8-6-4-3-5-7-8;8-6(9)5-3-1-2-4-7-5;/h3-6H,1-2H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | WKGRAFXVZZHLHI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|