C23H17F4IrN4O2- — CID 58426433
iridium;4-phenyl-3-phenyl-5-(1,1,2,2-tetrafluoropropyl)-1,2,4-triazole;pyridine-2-carboxylic acid (PubChem CID 58426433) has the molecular formula C23H17F4IrN4O2- and a molecular weight of 649.62 g/mol. Its IUPAC name is iridium;4-phenyl-3-phenyl-5-(1,1,2,2-tetrafluoropropyl)-1,2,4-triazole;pyridine-2-carboxylic acid.
| Compound Name | iridium;4-phenyl-3-phenyl-5-(1,1,2,2-tetrafluoropropyl)-1,2,4-triazole;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426433 |
| Molecular Formula | C23H17F4IrN4O2- |
| Molecular Weight | 649.62 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | iridium;4-phenyl-3-phenyl-5-(1,1,2,2-tetrafluoropropyl)-1,2,4-triazole;pyridine-2-carboxylic acid |
| SMILES | CC(F)(F)C(F)(F)c1nnc(-c2[c-]cccc2)n1-c1ccccc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C17H12F4N3.C6H5NO2.Ir/c1-16(18,19)17(20,21)15-23-22-14(12-8-4-2-5-9-12)24(15)13-10-6-3-7-11-13;8-6(9)5-3-1-2-4-7-5;/h2-8,10-11H,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | FAXYTBDXMHISKV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|