C25H23F2IrN4O2- — CID 58426445
3-(1,1-difluoropentyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid (PubChem CID 58426445) has the molecular formula C25H23F2IrN4O2- and a molecular weight of 641.70 g/mol. Its IUPAC name is 3-(1,1-difluoropentyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 3-(1,1-difluoropentyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426445 |
| Molecular Formula | C25H23F2IrN4O2- |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 642.14 |
| IUPAC Name | 3-(1,1-difluoropentyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
| SMILES | CCCCC(F)(F)c1nnc(-c2[c-]cccc2)n1-c1ccccc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C19H18F2N3.C6H5NO2.Ir/c1-2-3-14-19(20,21)18-23-22-17(15-10-6-4-7-11-15)24(18)16-12-8-5-9-13-16;8-6(9)5-3-1-2-4-7-5;/h4-10,12-13H,2-3,14H2,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | NMAWIFDDAQLYFP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|