C29H17F16IrN4O2- — CID 58426446
3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid (PubChem CID 58426446) has the molecular formula C29H17F16IrN4O2- and a molecular weight of 949.67 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426446 |
| Molecular Formula | C29H17F16IrN4O2- |
| Molecular Weight | 949.67 g/mol |
| Exact Mass | 950.07 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1nnc(-c2[c-]cccc2)n1-c1ccccc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C23H12F16N3.C6H5NO2.Ir/c1-16(24,25)18(28,29)20(32,33)22(36,37)23(38,39)21(34,35)19(30,31)17(26,27)15-41-40-14(12-8-4-2-5-9-12)42(15)13-10-6-3-7-11-13;8-6(9)5-3-1-2-4-7-5;/h2-8,10-11H,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | LQFQOWUZKBEGBN-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.67 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|