C27H25F2IrN4O2- — CID 58426409
3-[cyclohexyl(difluoro)methyl]-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid (PubChem CID 58426409) has the molecular formula C27H25F2IrN4O2- and a molecular weight of 667.74 g/mol. Its IUPAC name is 3-[cyclohexyl(difluoro)methyl]-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 3-[cyclohexyl(difluoro)methyl]-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426409 |
| Molecular Formula | C27H25F2IrN4O2- |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | 3-[cyclohexyl(difluoro)methyl]-4-phenyl-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
| SMILES | FC(F)(c1nnc(-c2[c-]cccc2)n1-c1ccccc1)C1CCCCC1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C21H20F2N3.C6H5NO2.Ir/c22-21(23,17-12-6-2-7-13-17)20-25-24-19(16-10-4-1-5-11-16)26(20)18-14-8-3-9-15-18;8-6(9)5-3-1-2-4-7-5;/h1,3-5,8-10,14-15,17H,2,6-7,12-13H2;1-4H,(H,8,9);/q-1;; |
| InChIKey | XDDJKRZXWUAKTM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|