C26H25F2IrN4O2- — CID 58426435
4-(4-tert-butylphenyl)-3-(1,1-difluoroethyl)-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid (PubChem CID 58426435) has the molecular formula C26H25F2IrN4O2- and a molecular weight of 655.73 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-3-(1,1-difluoroethyl)-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 4-(4-tert-butylphenyl)-3-(1,1-difluoroethyl)-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58426435 |
| Molecular Formula | C26H25F2IrN4O2- |
| Molecular Weight | 655.73 g/mol |
| Exact Mass | 656.16 |
| IUPAC Name | 4-(4-tert-butylphenyl)-3-(1,1-difluoroethyl)-5-phenyl-1,2,4-triazole;iridium;pyridine-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3[c-]cccc3)nnc2C(C)(F)F)cc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C20H20F2N3.C6H5NO2.Ir/c1-19(2,3)15-10-12-16(13-11-15)25-17(14-8-6-5-7-9-14)23-24-18(25)20(4,21)22;8-6(9)5-3-1-2-4-7-5;/h5-8,10-13H,1-4H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | DCYWYVVDBYVFBV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.73 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|