C23H22Li2N4 — CID 58163117
dilithium;1-methyl-4-[2-(1-methyl-2-phenylimidazol-4-yl)propan-2-yl]-2-phenylimidazole (PubChem CID 58163117) has the molecular formula C23H22Li2N4 and a molecular weight of 368.34 g/mol. Its IUPAC name is dilithium;1-methyl-4-[2-(1-methyl-2-phenylimidazol-4-yl)propan-2-yl]-2-phenylimidazole.
| Compound Name | dilithium;1-methyl-4-[2-(1-methyl-2-phenylimidazol-4-yl)propan-2-yl]-2-phenylimidazole |
|---|---|
| PubChem CID | 58163117 |
| Molecular Formula | C23H22Li2N4 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | dilithium;1-methyl-4-[2-(1-methyl-2-phenylimidazol-4-yl)propan-2-yl]-2-phenylimidazole |
| SMILES | Cn1cc(C(C)(C)c2cn(C)c(-c3[c-]cccc3)n2)nc1-c1[c-]cccc1.[Li+].[Li+] |
| InChI | InChI=1S/C23H22N4.2Li/c1-23(2,19-15-26(3)21(24-19)17-11-7-5-8-12-17)20-16-27(4)22(25-20)18-13-9-6-10-14-18;;/h5-11,13,15-16H,1-4H3;;/q-2;2*+1 |
| InChIKey | YATOHWAFCOPHHH-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|