C15H22O4 — CID 58165317
1-[4-(2-ethenoxyethoxy)phenyl]-2,2-dimethylpropane-1,3-diol (PubChem CID 58165317) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[4-(2-ethenoxyethoxy)phenyl]-2,2-dimethylpropane-1,3-diol.
| Compound Name | 1-[4-(2-ethenoxyethoxy)phenyl]-2,2-dimethylpropane-1,3-diol |
|---|---|
| PubChem CID | 58165317 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[4-(2-ethenoxyethoxy)phenyl]-2,2-dimethylpropane-1,3-diol |
| SMILES | C=COCCOc1ccc(C(O)C(C)(C)CO)cc1 |
| InChI | InChI=1S/C15H22O4/c1-4-18-9-10-19-13-7-5-12(6-8-13)14(17)15(2,3)11-16/h4-8,14,16-17H,1,9-11H2,2-3H3 |
| InChIKey | JHFXQIJUAJGJHW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|