C5H9N2+ — CID 58165728
[(3E)-penta-1,3-dien-3-yl]iminoazanium (PubChem CID 58165728) has the molecular formula C5H9N2+ and a molecular weight of 97.14 g/mol. Its IUPAC name is [(3E)-penta-1,3-dien-3-yl]iminoazanium.
| Compound Name | [(3E)-penta-1,3-dien-3-yl]iminoazanium |
|---|---|
| PubChem CID | 58165728 |
| Molecular Formula | C5H9N2+ |
| Molecular Weight | 97.14 g/mol |
| Exact Mass | 97.08 |
| IUPAC Name | [(3E)-penta-1,3-dien-3-yl]iminoazanium |
| SMILES | C=C/C(=C\C)N=[NH2+] |
| InChI | InChI=1S/C5H8N2/c1-3-5(4-2)7-6/h3-4,6H,1H2,2H3/p+1/b5-4+,7-6? |
| InChIKey | FSQFEXPARIVWOT-DBYMJTHYSA-O |
| XLogP | 0.29 |
| TPSA | 37.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.14 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|