C34H43N2O+ — CID 58165778
6-[(2E)-2-[(E)-3-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)prop-2-enylidene]-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl]hexan-1-ol (PubChem CID 58165778) has the molecular formula C34H43N2O+ and a molecular weight of 495.73 g/mol. Its IUPAC name is 6-[(2E)-2-[(E)-3-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)prop-2-enylidene]-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl]hexan-1-ol.
| Compound Name | 6-[(2E)-2-[(E)-3-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)prop-2-enylidene]-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl]hexan-1-ol |
|---|---|
| PubChem CID | 58165778 |
| Molecular Formula | C34H43N2O+ |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.34 |
| IUPAC Name | 6-[(2E)-2-[(E)-3-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)prop-2-enylidene]-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl]hexan-1-ol |
| SMILES | CC1(C)C(/C=C/C=C2/N3CCCc4cccc(c43)C2(C)CCCCCCO)=[N+]2CCCc3cccc1c32 |
| InChI | InChI=1S/C34H43N2O/c1-33(2)27-17-8-13-25-15-11-22-35(31(25)27)29(33)19-10-20-30-34(3,21-6-4-5-7-24-37)28-18-9-14-26-16-12-23-36(30)32(26)28/h8-10,13-14,17-20,37H,4-7,11-12,15-16,21-24H2,1-3H3/q+1 |
| InChIKey | LOERGEDHNMAUCV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|