C22H18N2O3 — CID 58167836
1-(3-methylfuran-2-yl)-2-[4-[[2-(1H-pyrrol-2-yl)-4-pyridinyl]oxy]phenyl]ethanone (PubChem CID 58167836) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-(3-methylfuran-2-yl)-2-[4-[[2-(1H-pyrrol-2-yl)-4-pyridinyl]oxy]phenyl]ethanone.
| Compound Name | 1-(3-methylfuran-2-yl)-2-[4-[[2-(1H-pyrrol-2-yl)-4-pyridinyl]oxy]phenyl]ethanone |
|---|---|
| PubChem CID | 58167836 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-(3-methylfuran-2-yl)-2-[4-[[2-(1H-pyrrol-2-yl)-4-pyridinyl]oxy]phenyl]ethanone |
| SMILES | Cc1ccoc1C(=O)Cc1ccc(Oc2ccnc(-c3ccc[nH]3)c2)cc1 |
| InChI | InChI=1S/C22H18N2O3/c1-15-9-12-26-22(15)21(25)13-16-4-6-17(7-5-16)27-18-8-11-24-20(14-18)19-3-2-10-23-19/h2-12,14,23H,13H2,1H3 |
| InChIKey | TUUQIMBMNYCXJD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |