C25H22N4O6 — CID 87246473
[methyl-[5-[4-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino] acetate (PubChem CID 87246473) has the molecular formula C25H22N4O6 and a molecular weight of 474.47 g/mol. Its IUPAC name is [methyl-[5-[4-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino] acetate.
| Compound Name | [methyl-[5-[4-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino] acetate |
|---|---|
| PubChem CID | 87246473 |
| Molecular Formula | C25H22N4O6 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [methyl-[5-[4-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino] acetate |
| SMILES | CC(=O)ON(C)C(=O)c1c[nH]c(-c2cc(Oc3cccc(NC(=O)c4occc4C)c3)ccn2)c1 |
| InChI | InChI=1S/C25H22N4O6/c1-15-8-10-33-23(15)24(31)28-18-5-4-6-19(12-18)34-20-7-9-26-22(13-20)21-11-17(14-27-21)25(32)29(3)35-16(2)30/h4-14,27H,1-3H3,(H,28,31) |
| InChIKey | VPZGGTPMBBLDTJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|