C30H34N4O5 — CID 123379948
tert-butyl 4-[[5-[4-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]-2-pyridinyl]-1H-pyrrol-3-yl]methylamino]butanoate (PubChem CID 123379948) has the molecular formula C30H34N4O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is tert-butyl 4-[[5-[4-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]-2-pyridinyl]-1H-pyrrol-3-yl]methylamino]butanoate.
| Compound Name | tert-butyl 4-[[5-[4-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]-2-pyridinyl]-1H-pyrrol-3-yl]methylamino]butanoate |
|---|---|
| PubChem CID | 123379948 |
| Molecular Formula | C30H34N4O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | tert-butyl 4-[[5-[4-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]-2-pyridinyl]-1H-pyrrol-3-yl]methylamino]butanoate |
| SMILES | Cc1ccoc1C(=O)Nc1cccc(Oc2ccnc(-c3cc(CNCCCC(=O)OC(C)(C)C)c[nH]3)c2)c1 |
| InChI | InChI=1S/C30H34N4O5/c1-20-11-14-37-28(20)29(36)34-22-7-5-8-23(16-22)38-24-10-13-32-26(17-24)25-15-21(19-33-25)18-31-12-6-9-27(35)39-30(2,3)4/h5,7-8,10-11,13-17,19,31,33H,6,9,12,18H2,1-4H3,(H,34,36) |
| InChIKey | OQMOZWAOKHNMID-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|