C32H27F4N5O3 — CID 58168238
N-[4-[[7-[4-(dimethylamino)butanoyl]-6-oxo-5H-benzo[c][1,8]naphthyridin-1-yl]amino]phenyl]-4-fluoro-2-(trifluoromethyl)benzamide (PubChem CID 58168238) has the molecular formula C32H27F4N5O3 and a molecular weight of 605.59 g/mol. Its IUPAC name is N-[4-[[7-[4-(dimethylamino)butanoyl]-6-oxo-5H-benzo[c][1,8]naphthyridin-1-yl]amino]phenyl]-4-fluoro-2-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[[7-[4-(dimethylamino)butanoyl]-6-oxo-5H-benzo[c][1,8]naphthyridin-1-yl]amino]phenyl]-4-fluoro-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58168238 |
| Molecular Formula | C32H27F4N5O3 |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | N-[4-[[7-[4-(dimethylamino)butanoyl]-6-oxo-5H-benzo[c][1,8]naphthyridin-1-yl]amino]phenyl]-4-fluoro-2-(trifluoromethyl)benzamide |
| SMILES | CN(C)CCCC(=O)c1cccc2c1c(=O)[nH]c1nccc(Nc3ccc(NC(=O)c4ccc(F)cc4C(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C32H27F4N5O3/c1-41(2)16-4-7-26(42)22-5-3-6-23-27(22)31(44)40-29-28(23)25(14-15-37-29)38-19-9-11-20(12-10-19)39-30(43)21-13-8-18(33)17-24(21)32(34,35)36/h3,5-6,8-15,17H,4,7,16H2,1-2H3,(H,39,43)(H2,37,38,40,44) |
| InChIKey | BTIPLRVUODIILA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|