C29H35N5O — CID 58170555
N-[4-[3-(1H-indol-3-yl)propyl]phenyl]-2-[(2-morpholin-4-ylethylamino)methyl]pyridin-4-amine (PubChem CID 58170555) has the molecular formula C29H35N5O and a molecular weight of 469.63 g/mol. Its IUPAC name is N-[4-[3-(1H-indol-3-yl)propyl]phenyl]-2-[(2-morpholin-4-ylethylamino)methyl]pyridin-4-amine.
| Compound Name | N-[4-[3-(1H-indol-3-yl)propyl]phenyl]-2-[(2-morpholin-4-ylethylamino)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 58170555 |
| Molecular Formula | C29H35N5O |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | N-[4-[3-(1H-indol-3-yl)propyl]phenyl]-2-[(2-morpholin-4-ylethylamino)methyl]pyridin-4-amine |
| SMILES | c1ccc2c(CCCc3ccc(Nc4ccnc(CNCCN5CCOCC5)c4)cc3)c[nH]c2c1 |
| InChI | InChI=1S/C29H35N5O/c1-2-7-29-28(6-1)24(21-32-29)5-3-4-23-8-10-25(11-9-23)33-26-12-13-31-27(20-26)22-30-14-15-34-16-18-35-19-17-34/h1-2,6-13,20-21,30,32H,3-5,14-19,22H2,(H,31,33) |
| InChIKey | LMKTVTXWDVEXIA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|