C26H29N3O2 — CID 58170578
N-[4-[3-(1H-indol-3-yl)propyl]phenyl]-2-(2-methoxyethoxymethyl)pyridin-4-amine (PubChem CID 58170578) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[4-[3-(1H-indol-3-yl)propyl]phenyl]-2-(2-methoxyethoxymethyl)pyridin-4-amine.
| Compound Name | N-[4-[3-(1H-indol-3-yl)propyl]phenyl]-2-(2-methoxyethoxymethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 58170578 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[4-[3-(1H-indol-3-yl)propyl]phenyl]-2-(2-methoxyethoxymethyl)pyridin-4-amine |
| SMILES | COCCOCc1cc(Nc2ccc(CCCc3c[nH]c4ccccc34)cc2)ccn1 |
| InChI | InChI=1S/C26H29N3O2/c1-30-15-16-31-19-24-17-23(13-14-27-24)29-22-11-9-20(10-12-22)5-4-6-21-18-28-26-8-3-2-7-25(21)26/h2-3,7-14,17-18,28H,4-6,15-16,19H2,1H3,(H,27,29) |
| InChIKey | AASWEZGBGQXBIQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|