C26H30N4 — CID 58170692
2-[1-(ethylamino)ethyl]-N-[4-[3-(1H-indol-3-yl)propyl]phenyl]pyridin-4-amine (PubChem CID 58170692) has the molecular formula C26H30N4 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[1-(ethylamino)ethyl]-N-[4-[3-(1H-indol-3-yl)propyl]phenyl]pyridin-4-amine.
| Compound Name | 2-[1-(ethylamino)ethyl]-N-[4-[3-(1H-indol-3-yl)propyl]phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 58170692 |
| Molecular Formula | C26H30N4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 2-[1-(ethylamino)ethyl]-N-[4-[3-(1H-indol-3-yl)propyl]phenyl]pyridin-4-amine |
| SMILES | CCNC(C)c1cc(Nc2ccc(CCCc3c[nH]c4ccccc34)cc2)ccn1 |
| InChI | InChI=1S/C26H30N4/c1-3-27-19(2)26-17-23(15-16-28-26)30-22-13-11-20(12-14-22)7-6-8-21-18-29-25-10-5-4-9-24(21)25/h4-5,9-19,27,29H,3,6-8H2,1-2H3,(H,28,30) |
| InChIKey | YOTMOBJHLQAHDP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |