C19H20N2O2 — CID 58170676
methyl 2-[(4-aminophenyl)methyl]-3-(1H-indol-3-yl)propanoate (PubChem CID 58170676) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl 2-[(4-aminophenyl)methyl]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[(4-aminophenyl)methyl]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 58170676 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | methyl 2-[(4-aminophenyl)methyl]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(N)cc1)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H20N2O2/c1-23-19(22)14(10-13-6-8-16(20)9-7-13)11-15-12-21-18-5-3-2-4-17(15)18/h2-9,12,14,21H,10-11,20H2,1H3 |
| InChIKey | ILSBBIQRTDPOLD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|