C28H24F2N2O5S — CID 58172949
4-[[7-[3-fluoro-4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]butanoic acid (PubChem CID 58172949) has the molecular formula C28H24F2N2O5S and a molecular weight of 538.57 g/mol. Its IUPAC name is 4-[[7-[3-fluoro-4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[7-[3-fluoro-4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 58172949 |
| Molecular Formula | C28H24F2N2O5S |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 4-[[7-[3-fluoro-4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]butanoic acid |
| SMILES | Cc1ccc(F)c(CC(=O)Cc2ccc(Oc3ccnc4cc(C(=O)NCCCC(=O)O)sc34)cc2F)c1 |
| InChI | InChI=1S/C28H24F2N2O5S/c1-16-4-7-21(29)18(11-16)13-19(33)12-17-5-6-20(14-22(17)30)37-24-8-10-31-23-15-25(38-27(23)24)28(36)32-9-2-3-26(34)35/h4-8,10-11,14-15H,2-3,9,12-13H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | OWHZEBPGBUAEHR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|